C25H30F3N3O4 — CID 170216381
3-[6-[(1S,2S)-2-[(4,4-difluorocyclohexyl)amino]cyclohexyl]oxy-7-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 170216381) has the molecular formula C25H30F3N3O4 and a molecular weight of 493.53 g/mol. Its IUPAC name is 3-[6-[(1S,2S)-2-[(4,4-difluorocyclohexyl)amino]cyclohexyl]oxy-7-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[(1S,2S)-2-[(4,4-difluorocyclohexyl)amino]cyclohexyl]oxy-7-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170216381 |
| Molecular Formula | C25H30F3N3O4 |
| Molecular Weight | 493.53 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | 3-[6-[(1S,2S)-2-[(4,4-difluorocyclohexyl)amino]cyclohexyl]oxy-7-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(ccc(O[C@H]4CCCC[C@@H]4NC4CCC(F)(F)CC4)c3F)C2=O)C(=O)N1 |
| InChI | InChI=1S/C25H30F3N3O4/c26-22-16-13-31(18-6-8-21(32)30-23(18)33)24(34)15(16)5-7-20(22)35-19-4-2-1-3-17(19)29-14-9-11-25(27,28)12-10-14/h5,7,14,17-19,29H,1-4,6,8-13H2,(H,30,32,33)/t17-,18?,19-/m0/s1 |
| InChIKey | JMLOXGVVMQJOEP-JVUMBYKBSA-N |
| XLogP | 3.44 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.53 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|