C26H35F2N3O4 — CID 169190639
1-(cyclohexylamino)-4,4-difluorocyclohexan-1-ol;3-(6-methyl-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione (PubChem CID 169190639) has the molecular formula C26H35F2N3O4 and a molecular weight of 491.58 g/mol. Its IUPAC name is 1-(cyclohexylamino)-4,4-difluorocyclohexan-1-ol;3-(6-methyl-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione.
| Compound Name | 1-(cyclohexylamino)-4,4-difluorocyclohexan-1-ol;3-(6-methyl-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 169190639 |
| Molecular Formula | C26H35F2N3O4 |
| Molecular Weight | 491.58 g/mol |
| Exact Mass | 491.26 |
| IUPAC Name | 1-(cyclohexylamino)-4,4-difluorocyclohexan-1-ol;3-(6-methyl-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione |
| SMILES | Cc1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2=O.OC1(NC2CCCCC2)CCC(F)(F)CC1 |
| InChI | InChI=1S/C14H14N2O3.C12H21F2NO/c1-8-2-3-10-9(6-8)7-16(14(10)19)11-4-5-12(17)15-13(11)18;13-11(14)6-8-12(16,9-7-11)15-10-4-2-1-3-5-10/h2-3,6,11H,4-5,7H2,1H3,(H,15,17,18);10,15-16H,1-9H2 |
| InChIKey | AXKUHSGYIRGUFW-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.58 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|