C27H41N3O4S — CID 169190900
N-cyclohexyl-1-oxothian-4-amine;ethane;3-(6-methyl-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione (PubChem CID 169190900) has the molecular formula C27H41N3O4S and a molecular weight of 503.71 g/mol. Its IUPAC name is N-cyclohexyl-1-oxothian-4-amine;ethane;3-(6-methyl-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione.
| Compound Name | N-cyclohexyl-1-oxothian-4-amine;ethane;3-(6-methyl-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 169190900 |
| Molecular Formula | C27H41N3O4S |
| Molecular Weight | 503.71 g/mol |
| Exact Mass | 503.28 |
| IUPAC Name | N-cyclohexyl-1-oxothian-4-amine;ethane;3-(6-methyl-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione |
| SMILES | CC.Cc1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2=O.O=S1CCC(NC2CCCCC2)CC1 |
| InChI | InChI=1S/C14H14N2O3.C11H21NOS.C2H6/c1-8-2-3-10-9(6-8)7-16(14(10)19)11-4-5-12(17)15-13(11)18;13-14-8-6-11(7-9-14)12-10-4-2-1-3-5-10;1-2/h2-3,6,11H,4-5,7H2,1H3,(H,15,17,18);10-12H,1-9H2;1-2H3 |
| InChIKey | WPFVNPMPBWGZJC-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.71 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|