C20H28IN3O4S — CID 153392033
N-ethylcyclopentanamine;3-(6-hydroxy-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione;thiohypoiodous acid (PubChem CID 153392033) has the molecular formula C20H28IN3O4S and a molecular weight of 533.43 g/mol. Its IUPAC name is N-ethylcyclopentanamine;3-(6-hydroxy-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione;thiohypoiodous acid.
| Compound Name | N-ethylcyclopentanamine;3-(6-hydroxy-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione;thiohypoiodous acid |
|---|---|
| PubChem CID | 153392033 |
| Molecular Formula | C20H28IN3O4S |
| Molecular Weight | 533.43 g/mol |
| Exact Mass | 533.08 |
| IUPAC Name | N-ethylcyclopentanamine;3-(6-hydroxy-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione;thiohypoiodous acid |
| SMILES | CCNC1CCCC1.O=C1CCC(N2Cc3cc(O)ccc3C2=O)C(=O)N1.SI |
| InChI | InChI=1S/C13H12N2O4.C7H15N.HIS/c16-8-1-2-9-7(5-8)6-15(13(9)19)10-3-4-11(17)14-12(10)18;1-2-8-7-5-3-4-6-7;1-2/h1-2,5,10,16H,3-4,6H2,(H,14,17,18);7-8H,2-6H2,1H3;2H |
| InChIKey | OYCJFPNMIZXSAX-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.43 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|