C14H14N2O4 — CID 146173302
3-(6-hydroxy-1-oxo-3,4-dihydroisoquinolin-2-yl)piperidine-2,6-dione (PubChem CID 146173302) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is 3-(6-hydroxy-1-oxo-3,4-dihydroisoquinolin-2-yl)piperidine-2,6-dione.
| Compound Name | 3-(6-hydroxy-1-oxo-3,4-dihydroisoquinolin-2-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 146173302 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 3-(6-hydroxy-1-oxo-3,4-dihydroisoquinolin-2-yl)piperidine-2,6-dione |
| SMILES | O=C1CCC(N2CCc3cc(O)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C14H14N2O4/c17-9-1-2-10-8(7-9)5-6-16(14(10)20)11-3-4-12(18)15-13(11)19/h1-2,7,11,17H,3-6H2,(H,15,18,19) |
| InChIKey | PLRRWLYLOSLODH-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|