C26H34BF2N3O3 — CID 169190903
CID 169190903 (PubChem CID 169190903) has the molecular formula C26H34BF2N3O3 and a molecular weight of 485.38 g/mol.
| Compound Name | CID 169190903 |
|---|---|
| PubChem CID | 169190903 |
| Molecular Formula | C26H34BF2N3O3 |
| Molecular Weight | 485.38 g/mol |
| Exact Mass | 485.27 |
| IUPAC Name | — |
| SMILES | Cc1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2=O.[B]C1(NC2CCCCC2)CCC(F)(F)CC1 |
| InChI | InChI=1S/C14H14N2O3.C12H20BF2N/c1-8-2-3-10-9(6-8)7-16(14(10)19)11-4-5-12(17)15-13(11)18;13-11(6-8-12(14,15)9-7-11)16-10-4-2-1-3-5-10/h2-3,6,11H,4-5,7H2,1H3,(H,15,17,18);10,16H,1-9H2 |
| InChIKey | RKBMIBFIFJQDNY-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.38 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|