C15H16BrN3O3 — CID 167274132
3-[6-(2-bromoethylamino)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167274132) has the molecular formula C15H16BrN3O3 and a molecular weight of 366.22 g/mol. Its IUPAC name is 3-[6-(2-bromoethylamino)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-(2-bromoethylamino)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167274132 |
| Molecular Formula | C15H16BrN3O3 |
| Molecular Weight | 366.22 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | 3-[6-(2-bromoethylamino)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(NCCBr)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C15H16BrN3O3/c16-5-6-17-10-1-2-11-9(7-10)8-19(15(11)22)12-3-4-13(20)18-14(12)21/h1-2,7,12,17H,3-6,8H2,(H,18,20,21) |
| InChIKey | CYPMMNCGKVZKQZ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.22 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|