C19H16FN3O5S — CID 164938612
N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-4-fluorobenzenesulfonamide (PubChem CID 164938612) has the molecular formula C19H16FN3O5S and a molecular weight of 417.42 g/mol. Its IUPAC name is N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 164938612 |
| Molecular Formula | C19H16FN3O5S |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-4-fluorobenzenesulfonamide |
| SMILES | O=C1CCC(N2Cc3cc(NS(=O)(=O)c4ccc(F)cc4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C19H16FN3O5S/c20-12-1-4-14(5-2-12)29(27,28)22-13-3-6-15-11(9-13)10-23(19(15)26)16-7-8-17(24)21-18(16)25/h1-6,9,16,22H,7-8,10H2,(H,21,24,25) |
| InChIKey | NPPIBCNNQVWRMH-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|