C17H16N4O5S2 — CID 167783597
N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-2-methyl-1,3-thiazole-5-sulfonamide (PubChem CID 167783597) has the molecular formula C17H16N4O5S2 and a molecular weight of 420.47 g/mol. Its IUPAC name is N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-2-methyl-1,3-thiazole-5-sulfonamide.
| Compound Name | N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-2-methyl-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 167783597 |
| Molecular Formula | C17H16N4O5S2 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-2-methyl-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1ncc(S(=O)(=O)Nc2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)s1 |
| InChI | InChI=1S/C17H16N4O5S2/c1-9-18-7-15(27-9)28(25,26)20-11-2-3-12-10(6-11)8-21(17(12)24)13-4-5-14(22)19-16(13)23/h2-3,6-7,13,20H,4-5,8H2,1H3,(H,19,22,23) |
| InChIKey | ZKTCFLAURHBQSW-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 125.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|