C19H15ClFN3O5S — CID 164938578
3-chloro-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-4-fluorobenzenesulfonamide (PubChem CID 164938578) has the molecular formula C19H15ClFN3O5S and a molecular weight of 451.86 g/mol. Its IUPAC name is 3-chloro-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-4-fluorobenzenesulfonamide.
| Compound Name | 3-chloro-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 164938578 |
| Molecular Formula | C19H15ClFN3O5S |
| Molecular Weight | 451.86 g/mol |
| Exact Mass | 451.04 |
| IUPAC Name | 3-chloro-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-4-fluorobenzenesulfonamide |
| SMILES | O=C1CCC(N2Cc3cc(NS(=O)(=O)c4ccc(F)c(Cl)c4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C19H15ClFN3O5S/c20-14-8-12(2-4-15(14)21)30(28,29)23-11-1-3-13-10(7-11)9-24(19(13)27)16-5-6-17(25)22-18(16)26/h1-4,7-8,16,23H,5-6,9H2,(H,22,25,26) |
| InChIKey | ZDZNQRHSDRUVIF-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.86 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|