C20H17Cl2N3O5S — CID 167773219
2,5-dichloro-N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]benzenesulfonamide (PubChem CID 167773219) has the molecular formula C20H17Cl2N3O5S and a molecular weight of 482.35 g/mol. Its IUPAC name is 2,5-dichloro-N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]benzenesulfonamide.
| Compound Name | 2,5-dichloro-N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 167773219 |
| Molecular Formula | C20H17Cl2N3O5S |
| Molecular Weight | 482.35 g/mol |
| Exact Mass | 481.03 |
| IUPAC Name | 2,5-dichloro-N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]benzenesulfonamide |
| SMILES | O=C1CCC(N2Cc3cc(CNS(=O)(=O)c4cc(Cl)ccc4Cl)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C20H17Cl2N3O5S/c21-13-2-4-15(22)17(8-13)31(29,30)23-9-11-1-3-14-12(7-11)10-25(20(14)28)16-5-6-18(26)24-19(16)27/h1-4,7-8,16,23H,5-6,9-10H2,(H,24,26,27) |
| InChIKey | FNMDPSODUMREOD-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.35 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|