C22H18ClN5O4 — CID 168880037
6-chloro-N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-1H-indazole-3-carboxamide (PubChem CID 168880037) has the molecular formula C22H18ClN5O4 and a molecular weight of 451.87 g/mol. Its IUPAC name is 6-chloro-N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-1H-indazole-3-carboxamide.
| Compound Name | 6-chloro-N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 168880037 |
| Molecular Formula | C22H18ClN5O4 |
| Molecular Weight | 451.87 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | 6-chloro-N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-1H-indazole-3-carboxamide |
| SMILES | O=C1CCC(N2Cc3cc(CNC(=O)c4n[nH]c5cc(Cl)ccc45)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C22H18ClN5O4/c23-13-2-4-15-16(8-13)26-27-19(15)21(31)24-9-11-1-3-14-12(7-11)10-28(22(14)32)17-5-6-18(29)25-20(17)30/h1-4,7-8,17H,5-6,9-10H2,(H,24,31)(H,26,27)(H,25,29,30) |
| InChIKey | APUQYFVUIQLWGH-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 124.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.87 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|