C25H21ClN4O4 — CID 168880086
4-(3-chlorophenyl)-N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-1H-pyrrole-2-carboxamide (PubChem CID 168880086) has the molecular formula C25H21ClN4O4 and a molecular weight of 476.92 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-(3-chlorophenyl)-N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 168880086 |
| Molecular Formula | C25H21ClN4O4 |
| Molecular Weight | 476.92 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | 4-(3-chlorophenyl)-N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-1H-pyrrole-2-carboxamide |
| SMILES | O=C1CCC(N2Cc3cc(CNC(=O)c4cc(-c5cccc(Cl)c5)c[nH]4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C25H21ClN4O4/c26-18-3-1-2-15(9-18)16-10-20(27-12-16)23(32)28-11-14-4-5-19-17(8-14)13-30(25(19)34)21-6-7-22(31)29-24(21)33/h1-5,8-10,12,21,27H,6-7,11,13H2,(H,28,32)(H,29,31,33) |
| InChIKey | DPCQCNUUCOCLND-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.92 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|