C24H19ClN4O5 — CID 168880095
5-(4-chlorophenyl)-N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-1,2-oxazole-3-carboxamide (PubChem CID 168880095) has the molecular formula C24H19ClN4O5 and a molecular weight of 478.89 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 168880095 |
| Molecular Formula | C24H19ClN4O5 |
| Molecular Weight | 478.89 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | 5-(4-chlorophenyl)-N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-1,2-oxazole-3-carboxamide |
| SMILES | O=C1CCC(N2Cc3cc(CNC(=O)c4cc(-c5ccc(Cl)cc5)on4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C24H19ClN4O5/c25-16-4-2-14(3-5-16)20-10-18(28-34-20)22(31)26-11-13-1-6-17-15(9-13)12-29(24(17)33)19-7-8-21(30)27-23(19)32/h1-6,9-10,19H,7-8,11-12H2,(H,26,31)(H,27,30,32) |
| InChIKey | NXQOIZIZMLQXGU-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 121.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.89 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|