C23H18ClN3O5 — CID 147745475
7-chloro-2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-4H-isoquinoline-1,3-dione (PubChem CID 147745475) has the molecular formula C23H18ClN3O5 and a molecular weight of 451.87 g/mol. Its IUPAC name is 7-chloro-2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-4H-isoquinoline-1,3-dione.
| Compound Name | 7-chloro-2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-4H-isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 147745475 |
| Molecular Formula | C23H18ClN3O5 |
| Molecular Weight | 451.87 g/mol |
| Exact Mass | 451.09 |
| IUPAC Name | 7-chloro-2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-4H-isoquinoline-1,3-dione |
| SMILES | O=C1CCC(N2Cc3cc(CN4C(=O)Cc5ccc(Cl)cc5C4=O)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H18ClN3O5/c24-15-3-2-13-8-20(29)27(23(32)17(13)9-15)10-12-1-4-16-14(7-12)11-26(22(16)31)18-5-6-19(28)25-21(18)30/h1-4,7,9,18H,5-6,8,10-11H2,(H,25,28,30) |
| InChIKey | HBELBDKHVOBIJB-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.87 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|