C22H17ClN4O4 — CID 59443305
3-[6-[(6-chloro-4-oxoquinazolin-3-yl)methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 59443305) has the molecular formula C22H17ClN4O4 and a molecular weight of 436.86 g/mol. Its IUPAC name is 3-[6-[(6-chloro-4-oxoquinazolin-3-yl)methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[(6-chloro-4-oxoquinazolin-3-yl)methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 59443305 |
| Molecular Formula | C22H17ClN4O4 |
| Molecular Weight | 436.86 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | 3-[6-[(6-chloro-4-oxoquinazolin-3-yl)methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(Cn4cnc5ccc(Cl)cc5c4=O)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C22H17ClN4O4/c23-14-2-4-17-16(8-14)21(30)26(11-24-17)9-12-1-3-15-13(7-12)10-27(22(15)31)18-5-6-19(28)25-20(18)29/h1-4,7-8,11,18H,5-6,9-10H2,(H,25,28,29) |
| InChIKey | GEEDLAJRTPWABV-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.86 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|