C23H18ClF2N5O3 — CID 172562441
3-[6-[[4-[(4-chlorophenyl)-difluoromethyl]triazol-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 172562441) has the molecular formula C23H18ClF2N5O3 and a molecular weight of 485.88 g/mol. Its IUPAC name is 3-[6-[[4-[(4-chlorophenyl)-difluoromethyl]triazol-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[[4-[(4-chlorophenyl)-difluoromethyl]triazol-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 172562441 |
| Molecular Formula | C23H18ClF2N5O3 |
| Molecular Weight | 485.88 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | 3-[6-[[4-[(4-chlorophenyl)-difluoromethyl]triazol-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(Cn4cc(C(F)(F)c5ccc(Cl)cc5)nn4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H18ClF2N5O3/c24-16-4-2-15(3-5-16)23(25,26)19-12-30(29-28-19)10-13-1-6-17-14(9-13)11-31(22(17)34)18-7-8-20(32)27-21(18)33/h1-6,9,12,18H,7-8,10-11H2,(H,27,32,33) |
| InChIKey | ULFVPHRWDNFREL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.88 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|