C20H17F2N3O6S — CID 166426668
2-(difluoromethoxy)-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]benzenesulfonamide (PubChem CID 166426668) has the molecular formula C20H17F2N3O6S and a molecular weight of 465.43 g/mol. Its IUPAC name is 2-(difluoromethoxy)-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]benzenesulfonamide.
| Compound Name | 2-(difluoromethoxy)-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 166426668 |
| Molecular Formula | C20H17F2N3O6S |
| Molecular Weight | 465.43 g/mol |
| Exact Mass | 465.08 |
| IUPAC Name | 2-(difluoromethoxy)-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]benzenesulfonamide |
| SMILES | O=C1CCC(N2Cc3cc(NS(=O)(=O)c4ccccc4OC(F)F)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C20H17F2N3O6S/c21-20(22)31-15-3-1-2-4-16(15)32(29,30)24-12-5-6-13-11(9-12)10-25(19(13)28)14-7-8-17(26)23-18(14)27/h1-6,9,14,20,24H,7-8,10H2,(H,23,26,27) |
| InChIKey | VCTSFRAPUUMVEY-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.43 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|