C22H19F2N3O7S — CID 169222728
2-(difluoromethoxy)-N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-3-ethylbenzenesulfonamide (PubChem CID 169222728) has the molecular formula C22H19F2N3O7S and a molecular weight of 507.47 g/mol. Its IUPAC name is 2-(difluoromethoxy)-N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-3-ethylbenzenesulfonamide.
| Compound Name | 2-(difluoromethoxy)-N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-3-ethylbenzenesulfonamide |
|---|---|
| PubChem CID | 169222728 |
| Molecular Formula | C22H19F2N3O7S |
| Molecular Weight | 507.47 g/mol |
| Exact Mass | 507.09 |
| IUPAC Name | 2-(difluoromethoxy)-N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-3-ethylbenzenesulfonamide |
| SMILES | CCc1cccc(S(=O)(=O)Nc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3=O)c1OC(F)F |
| InChI | InChI=1S/C22H19F2N3O7S/c1-2-11-4-3-5-16(18(11)34-22(23)24)35(32,33)26-12-6-7-13-14(10-12)21(31)27(20(13)30)15-8-9-17(28)25-19(15)29/h3-7,10,15,22,26H,2,8-9H2,1H3,(H,25,28,29) |
| InChIKey | PXSOKLASZRTKJZ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.47 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|