C20H16ClN3O7S — CID 167175297
5-chloro-N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-2-methoxybenzenesulfonamide (PubChem CID 167175297) has the molecular formula C20H16ClN3O7S and a molecular weight of 477.88 g/mol. Its IUPAC name is 5-chloro-N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-2-methoxybenzenesulfonamide.
| Compound Name | 5-chloro-N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 167175297 |
| Molecular Formula | C20H16ClN3O7S |
| Molecular Weight | 477.88 g/mol |
| Exact Mass | 477.04 |
| IUPAC Name | 5-chloro-N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-2-methoxybenzenesulfonamide |
| SMILES | COc1ccc(Cl)cc1S(=O)(=O)Nc1ccc2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C20H16ClN3O7S/c1-31-15-6-2-10(21)8-16(15)32(29,30)23-11-3-4-12-13(9-11)20(28)24(19(12)27)14-5-7-17(25)22-18(14)26/h2-4,6,8-9,14,23H,5,7H2,1H3,(H,22,25,26) |
| InChIKey | PUGVZGISZCTSSK-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.88 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|