C19H14ClN3O6S — CID 164938543
3-chloro-N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]benzenesulfonamide (PubChem CID 164938543) has the molecular formula C19H14ClN3O6S and a molecular weight of 447.86 g/mol. Its IUPAC name is 3-chloro-N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]benzenesulfonamide.
| Compound Name | 3-chloro-N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 164938543 |
| Molecular Formula | C19H14ClN3O6S |
| Molecular Weight | 447.86 g/mol |
| Exact Mass | 447.03 |
| IUPAC Name | 3-chloro-N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]benzenesulfonamide |
| SMILES | O=C1CCC(N2C(=O)c3ccc(NS(=O)(=O)c4cccc(Cl)c4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C19H14ClN3O6S/c20-10-2-1-3-12(8-10)30(28,29)22-11-4-5-13-14(9-11)19(27)23(18(13)26)15-6-7-16(24)21-17(15)25/h1-5,8-9,15,22H,6-7H2,(H,21,24,25) |
| InChIKey | HLDGYGDHHNONSV-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.86 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|