C24H25N3O7S — CID 166985426
N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-4-methyl-2-[(2-methylpropan-2-yl)oxy]benzenesulfonamide (PubChem CID 166985426) has the molecular formula C24H25N3O7S and a molecular weight of 499.55 g/mol. Its IUPAC name is N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-4-methyl-2-[(2-methylpropan-2-yl)oxy]benzenesulfonamide.
| Compound Name | N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-4-methyl-2-[(2-methylpropan-2-yl)oxy]benzenesulfonamide |
|---|---|
| PubChem CID | 166985426 |
| Molecular Formula | C24H25N3O7S |
| Molecular Weight | 499.55 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-4-methyl-2-[(2-methylpropan-2-yl)oxy]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3=O)c(OC(C)(C)C)c1 |
| InChI | InChI=1S/C24H25N3O7S/c1-13-5-9-19(18(11-13)34-24(2,3)4)35(32,33)26-14-6-7-15-16(12-14)23(31)27(22(15)30)17-8-10-20(28)25-21(17)29/h5-7,9,11-12,17,26H,8,10H2,1-4H3,(H,25,28,29) |
| InChIKey | SRTHJSTUKOTBIE-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.55 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|