C19H13Cl2N3O6S — CID 164938604
N-[4,6-dichloro-2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]benzenesulfonamide (PubChem CID 164938604) has the molecular formula C19H13Cl2N3O6S and a molecular weight of 482.30 g/mol. Its IUPAC name is N-[4,6-dichloro-2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]benzenesulfonamide.
| Compound Name | N-[4,6-dichloro-2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 164938604 |
| Molecular Formula | C19H13Cl2N3O6S |
| Molecular Weight | 482.30 g/mol |
| Exact Mass | 480.99 |
| IUPAC Name | N-[4,6-dichloro-2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]benzenesulfonamide |
| SMILES | O=C1CCC(N2C(=O)c3cc(Cl)c(NS(=O)(=O)c4ccccc4)c(Cl)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C19H13Cl2N3O6S/c20-11-8-10-14(15(21)16(11)23-31(29,30)9-4-2-1-3-5-9)19(28)24(18(10)27)12-6-7-13(25)22-17(12)26/h1-5,8,12,23H,6-7H2,(H,22,25,26) |
| InChIKey | CJYZFTCHNZAPQP-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.30 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|