C19H15N3O4 — CID 139184599
4-anilino-2-[(3S)-2,6-dioxopiperidin-3-yl]isoindole-1,3-dione (PubChem CID 139184599) has the molecular formula C19H15N3O4 and a molecular weight of 349.35 g/mol. Its IUPAC name is 4-anilino-2-[(3S)-2,6-dioxopiperidin-3-yl]isoindole-1,3-dione.
| Compound Name | 4-anilino-2-[(3S)-2,6-dioxopiperidin-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 139184599 |
| Molecular Formula | C19H15N3O4 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 4-anilino-2-[(3S)-2,6-dioxopiperidin-3-yl]isoindole-1,3-dione |
| SMILES | O=C1CC[C@H](N2C(=O)c3cccc(Nc4ccccc4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C19H15N3O4/c23-15-10-9-14(17(24)21-15)22-18(25)12-7-4-8-13(16(12)19(22)26)20-11-5-2-1-3-6-11/h1-8,14,20H,9-10H2,(H,21,23,24)/t14-/m0/s1 |
| InChIKey | MEYKZCUSYIEQSY-AWEZNQCLSA-N |
| XLogP | 1.83 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|