C25H26N4O6 — CID 58827325
2-(2,6-dioxopiperidin-3-yl)-4-[3-(2-morpholin-4-ylethoxy)anilino]isoindole-1,3-dione (PubChem CID 58827325) has the molecular formula C25H26N4O6 and a molecular weight of 478.51 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-[3-(2-morpholin-4-ylethoxy)anilino]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-[3-(2-morpholin-4-ylethoxy)anilino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 58827325 |
| Molecular Formula | C25H26N4O6 |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-[3-(2-morpholin-4-ylethoxy)anilino]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc(Nc4cccc(OCCN5CCOCC5)c4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C25H26N4O6/c30-21-8-7-20(23(31)27-21)29-24(32)18-5-2-6-19(22(18)25(29)33)26-16-3-1-4-17(15-16)35-14-11-28-9-12-34-13-10-28/h1-6,15,20,26H,7-14H2,(H,27,30,31) |
| InChIKey | KPYUVWANUCMXGX-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|