C24H33N5O5 — CID 170395243
4-[3-[3-(4-aminopiperidin-1-yl)propoxy]propylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 170395243) has the molecular formula C24H33N5O5 and a molecular weight of 471.56 g/mol. Its IUPAC name is 4-[3-[3-(4-aminopiperidin-1-yl)propoxy]propylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-[3-[3-(4-aminopiperidin-1-yl)propoxy]propylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 170395243 |
| Molecular Formula | C24H33N5O5 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | 4-[3-[3-(4-aminopiperidin-1-yl)propoxy]propylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | NC1CCN(CCCOCCCNc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)CC1 |
| InChI | InChI=1S/C24H33N5O5/c25-16-8-12-28(13-9-16)11-3-15-34-14-2-10-26-18-5-1-4-17-21(18)24(33)29(23(17)32)19-6-7-20(30)27-22(19)31/h1,4-5,16,19,26H,2-3,6-15,25H2,(H,27,30,31) |
| InChIKey | LMMFVNAYODGVIE-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 134.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|