C14H12N2O6 — CID 163267813
2-(2,6-dioxopiperidin-3-yl)-5-hydroxy-6-methoxyisoindole-1,3-dione (PubChem CID 163267813) has the molecular formula C14H12N2O6 and a molecular weight of 304.26 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-hydroxy-6-methoxyisoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-hydroxy-6-methoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 163267813 |
| Molecular Formula | C14H12N2O6 |
| Molecular Weight | 304.26 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-hydroxy-6-methoxyisoindole-1,3-dione |
| SMILES | COc1cc2c(cc1O)C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C14H12N2O6/c1-22-10-5-7-6(4-9(10)17)13(20)16(14(7)21)8-2-3-11(18)15-12(8)19/h4-5,8,17H,2-3H2,1H3,(H,15,18,19) |
| InChIKey | QAHIZNTTWSDGBU-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.26 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|