C20H26N4O5 — CID 134580304
tert-butyl N-[2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]amino]ethyl]carbamate (PubChem CID 134580304) has the molecular formula C20H26N4O5 and a molecular weight of 402.45 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 134580304 |
| Molecular Formula | C20H26N4O5 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | tert-butyl N-[2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNc1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C20H26N4O5/c1-20(2,3)29-19(28)22-9-8-21-13-4-5-14-12(10-13)11-24(18(14)27)15-6-7-16(25)23-17(15)26/h4-5,10,15,21H,6-9,11H2,1-3H3,(H,22,28)(H,23,25,26) |
| InChIKey | FYWXROHMEFOKIZ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|