C31H42N6O7 — CID 156528211
1-[2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]amino]ethyl]-3-[4-[2-[2-(2-propoxyethoxy)ethoxy]ethylamino]phenyl]urea (PubChem CID 156528211) has the molecular formula C31H42N6O7 and a molecular weight of 610.71 g/mol. Its IUPAC name is 1-[2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]amino]ethyl]-3-[4-[2-[2-(2-propoxyethoxy)ethoxy]ethylamino]phenyl]urea.
| Compound Name | 1-[2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]amino]ethyl]-3-[4-[2-[2-(2-propoxyethoxy)ethoxy]ethylamino]phenyl]urea |
|---|---|
| PubChem CID | 156528211 |
| Molecular Formula | C31H42N6O7 |
| Molecular Weight | 610.71 g/mol |
| Exact Mass | 610.31 |
| IUPAC Name | 1-[2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]amino]ethyl]-3-[4-[2-[2-(2-propoxyethoxy)ethoxy]ethylamino]phenyl]urea |
| SMILES | CCCOCCOCCOCCNc1ccc(NC(=O)NCCNc2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)cc1 |
| InChI | InChI=1S/C31H42N6O7/c1-2-14-42-16-18-44-19-17-43-15-13-33-23-3-5-24(6-4-23)35-31(41)34-12-11-32-25-7-8-26-22(20-25)21-37(30(26)40)27-9-10-28(38)36-29(27)39/h3-8,20,27,32-33H,2,9-19,21H2,1H3,(H2,34,35,41)(H,36,38,39) |
| InChIKey | NHPKXWGDTYNKLP-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 159.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.71 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|