C30H39N5O7 — CID 156527858
2-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]amino]-N-[[4-[2-[2-(2-ethoxyethoxy)ethoxy]ethylamino]phenyl]methyl]acetamide (PubChem CID 156527858) has the molecular formula C30H39N5O7 and a molecular weight of 581.67 g/mol. Its IUPAC name is 2-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]amino]-N-[[4-[2-[2-(2-ethoxyethoxy)ethoxy]ethylamino]phenyl]methyl]acetamide.
| Compound Name | 2-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]amino]-N-[[4-[2-[2-(2-ethoxyethoxy)ethoxy]ethylamino]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 156527858 |
| Molecular Formula | C30H39N5O7 |
| Molecular Weight | 581.67 g/mol |
| Exact Mass | 581.28 |
| IUPAC Name | 2-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]amino]-N-[[4-[2-[2-(2-ethoxyethoxy)ethoxy]ethylamino]phenyl]methyl]acetamide |
| SMILES | CCOCCOCCOCCNc1ccc(CNC(=O)CNc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3)cc1 |
| InChI | InChI=1S/C30H39N5O7/c1-2-40-13-14-42-16-15-41-12-11-31-23-6-3-21(4-7-23)18-33-28(37)19-32-24-8-5-22-20-35(30(39)25(22)17-24)26-9-10-27(36)34-29(26)38/h3-8,17,26,31-32H,2,9-16,18-20H2,1H3,(H,33,37)(H,34,36,38) |
| InChIKey | CPLONSMJPJJGRY-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 147.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.67 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|