C30H38N4O7 — CID 156528279
2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-7-phenyl-3H-isoindol-5-yl]amino]-N-[2-[2-(2-propoxyethoxy)ethoxy]ethyl]acetamide (PubChem CID 156528279) has the molecular formula C30H38N4O7 and a molecular weight of 566.66 g/mol. Its IUPAC name is 2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-7-phenyl-3H-isoindol-5-yl]amino]-N-[2-[2-(2-propoxyethoxy)ethoxy]ethyl]acetamide.
| Compound Name | 2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-7-phenyl-3H-isoindol-5-yl]amino]-N-[2-[2-(2-propoxyethoxy)ethoxy]ethyl]acetamide |
|---|---|
| PubChem CID | 156528279 |
| Molecular Formula | C30H38N4O7 |
| Molecular Weight | 566.66 g/mol |
| Exact Mass | 566.27 |
| IUPAC Name | 2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-7-phenyl-3H-isoindol-5-yl]amino]-N-[2-[2-(2-propoxyethoxy)ethoxy]ethyl]acetamide |
| SMILES | CCCOCCOCCOCCNC(=O)CNc1cc2c(c(-c3ccccc3)c1)C(=O)N(C1CCC(=O)NC1=O)C2 |
| InChI | InChI=1S/C30H38N4O7/c1-2-11-39-13-15-41-16-14-40-12-10-31-27(36)19-32-23-17-22-20-34(25-8-9-26(35)33-29(25)37)30(38)28(22)24(18-23)21-6-4-3-5-7-21/h3-7,17-18,25,32H,2,8-16,19-20H2,1H3,(H,31,36)(H,33,35,37) |
| InChIKey | KMRFWEINFQVYLB-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 135.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.66 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|