C30H36N8O7 — CID 156528041
N-[2-[2-[2-(aminomethoxy)ethoxy]ethoxy]ethyl]-2-[[4-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]amino]quinazolin-7-yl]amino]acetamide (PubChem CID 156528041) has the molecular formula C30H36N8O7 and a molecular weight of 620.67 g/mol. Its IUPAC name is N-[2-[2-[2-(aminomethoxy)ethoxy]ethoxy]ethyl]-2-[[4-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]amino]quinazolin-7-yl]amino]acetamide.
| Compound Name | N-[2-[2-[2-(aminomethoxy)ethoxy]ethoxy]ethyl]-2-[[4-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]amino]quinazolin-7-yl]amino]acetamide |
|---|---|
| PubChem CID | 156528041 |
| Molecular Formula | C30H36N8O7 |
| Molecular Weight | 620.67 g/mol |
| Exact Mass | 620.27 |
| IUPAC Name | N-[2-[2-[2-(aminomethoxy)ethoxy]ethoxy]ethyl]-2-[[4-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]amino]quinazolin-7-yl]amino]acetamide |
| SMILES | NCOCCOCCOCCNC(=O)CNc1ccc2c(Nc3ccc4c(c3)C(=O)N(C3CCC(=O)NC3=O)C4)ncnc2c1 |
| InChI | InChI=1S/C30H36N8O7/c31-17-45-12-11-44-10-9-43-8-7-32-27(40)15-33-20-3-4-22-24(14-20)34-18-35-28(22)36-21-2-1-19-16-38(30(42)23(19)13-21)25-5-6-26(39)37-29(25)41/h1-4,13-14,18,25,33H,5-12,15-17,31H2,(H,32,40)(H,34,35,36)(H,37,39,41) |
| InChIKey | LWPYXIOAGKDGEV-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 199.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.67 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|