C30H34N6O9 — CID 156527856
2-[4-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]amino]quinazolin-6-yl]oxy-N-[2-[2-[2-(hydroxymethoxy)ethoxy]ethoxy]ethyl]acetamide (PubChem CID 156527856) has the molecular formula C30H34N6O9 and a molecular weight of 622.63 g/mol. Its IUPAC name is 2-[4-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]amino]quinazolin-6-yl]oxy-N-[2-[2-[2-(hydroxymethoxy)ethoxy]ethoxy]ethyl]acetamide.
| Compound Name | 2-[4-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]amino]quinazolin-6-yl]oxy-N-[2-[2-[2-(hydroxymethoxy)ethoxy]ethoxy]ethyl]acetamide |
|---|---|
| PubChem CID | 156527856 |
| Molecular Formula | C30H34N6O9 |
| Molecular Weight | 622.63 g/mol |
| Exact Mass | 622.24 |
| IUPAC Name | 2-[4-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]amino]quinazolin-6-yl]oxy-N-[2-[2-[2-(hydroxymethoxy)ethoxy]ethoxy]ethyl]acetamide |
| SMILES | O=C(COc1ccc2ncnc(Nc3ccc4c(c3)C(=O)N(C3CCC(=O)NC3=O)C4)c2c1)NCCOCCOCCOCO |
| InChI | InChI=1S/C30H34N6O9/c37-18-44-12-11-43-10-9-42-8-7-31-27(39)16-45-21-3-4-24-23(14-21)28(33-17-32-24)34-20-2-1-19-15-36(30(41)22(19)13-20)25-5-6-26(38)35-29(25)40/h1-4,13-14,17,25,37H,5-12,15-16,18H2,(H,31,39)(H,32,33,34)(H,35,38,40) |
| InChIKey | IMTQLJBPCFBOSV-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 190.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.63 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|