C28H34N8O7S — CID 156528311
N-[2-[2-[2-(aminomethoxy)ethoxy]ethoxy]ethyl]-2-[[4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]amino]thieno[2,3-d]pyrimidin-5-yl]amino]acetamide (PubChem CID 156528311) has the molecular formula C28H34N8O7S and a molecular weight of 626.70 g/mol. Its IUPAC name is N-[2-[2-[2-(aminomethoxy)ethoxy]ethoxy]ethyl]-2-[[4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]amino]thieno[2,3-d]pyrimidin-5-yl]amino]acetamide.
| Compound Name | N-[2-[2-[2-(aminomethoxy)ethoxy]ethoxy]ethyl]-2-[[4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]amino]thieno[2,3-d]pyrimidin-5-yl]amino]acetamide |
|---|---|
| PubChem CID | 156528311 |
| Molecular Formula | C28H34N8O7S |
| Molecular Weight | 626.70 g/mol |
| Exact Mass | 626.23 |
| IUPAC Name | N-[2-[2-[2-(aminomethoxy)ethoxy]ethoxy]ethyl]-2-[[4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]amino]thieno[2,3-d]pyrimidin-5-yl]amino]acetamide |
| SMILES | NCOCCOCCOCCNC(=O)CNc1csc2ncnc(Nc3ccc4c(c3)CN(C3CCC(=O)NC3=O)C4=O)c12 |
| InChI | InChI=1S/C28H34N8O7S/c29-15-43-10-9-42-8-7-41-6-5-30-23(38)12-31-20-14-44-27-24(20)25(32-16-33-27)34-18-1-2-19-17(11-18)13-36(28(19)40)21-3-4-22(37)35-26(21)39/h1-2,11,14,16,21,31H,3-10,12-13,15,29H2,(H,30,38)(H,32,33,34)(H,35,37,39) |
| InChIKey | MWLYNDSGUUBZSX-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 199.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.70 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|