C29H43N7O9 — CID 156528533
N-[2-[2-[2-(aminomethoxy)ethoxy]ethoxy]ethyl]-2-[[2-(2,6-dioxopiperidin-3-yl)-5-[[2-(2-methylpiperazin-1-yl)-2-oxoethyl]amino]-3-oxo-1H-isoindol-4-yl]oxy]acetamide (PubChem CID 156528533) has the molecular formula C29H43N7O9 and a molecular weight of 633.70 g/mol. Its IUPAC name is N-[2-[2-[2-(aminomethoxy)ethoxy]ethoxy]ethyl]-2-[[2-(2,6-dioxopiperidin-3-yl)-5-[[2-(2-methylpiperazin-1-yl)-2-oxoethyl]amino]-3-oxo-1H-isoindol-4-yl]oxy]acetamide.
| Compound Name | N-[2-[2-[2-(aminomethoxy)ethoxy]ethoxy]ethyl]-2-[[2-(2,6-dioxopiperidin-3-yl)-5-[[2-(2-methylpiperazin-1-yl)-2-oxoethyl]amino]-3-oxo-1H-isoindol-4-yl]oxy]acetamide |
|---|---|
| PubChem CID | 156528533 |
| Molecular Formula | C29H43N7O9 |
| Molecular Weight | 633.70 g/mol |
| Exact Mass | 633.31 |
| IUPAC Name | N-[2-[2-[2-(aminomethoxy)ethoxy]ethoxy]ethyl]-2-[[2-(2,6-dioxopiperidin-3-yl)-5-[[2-(2-methylpiperazin-1-yl)-2-oxoethyl]amino]-3-oxo-1H-isoindol-4-yl]oxy]acetamide |
| SMILES | CC1CNCCN1C(=O)CNc1ccc2c(c1OCC(=O)NCCOCCOCCOCN)C(=O)N(C1CCC(=O)NC1=O)C2 |
| InChI | InChI=1S/C29H43N7O9/c1-19-14-31-6-8-35(19)25(39)15-33-21-3-2-20-16-36(22-4-5-23(37)34-28(22)40)29(41)26(20)27(21)45-17-24(38)32-7-9-42-10-11-43-12-13-44-18-30/h2-3,19,22,31,33H,4-18,30H2,1H3,(H,32,38)(H,34,37,40) |
| InChIKey | XBZRZBQMJVXMQA-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 202.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.70 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|