C28H37N7O9 — CID 156528344
2-(2,6-dioxopiperidin-3-yl)-N-[2-[2-[2-(hydroxymethoxy)ethoxy]ethoxy]ethyl]-5-[[2-[methyl(1H-pyrazol-4-ylmethyl)amino]-2-oxoethyl]amino]-3-oxo-1H-isoindole-4-carboxamide (PubChem CID 156528344) has the molecular formula C28H37N7O9 and a molecular weight of 615.64 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-N-[2-[2-[2-(hydroxymethoxy)ethoxy]ethoxy]ethyl]-5-[[2-[methyl(1H-pyrazol-4-ylmethyl)amino]-2-oxoethyl]amino]-3-oxo-1H-isoindole-4-carboxamide.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-N-[2-[2-[2-(hydroxymethoxy)ethoxy]ethoxy]ethyl]-5-[[2-[methyl(1H-pyrazol-4-ylmethyl)amino]-2-oxoethyl]amino]-3-oxo-1H-isoindole-4-carboxamide |
|---|---|
| PubChem CID | 156528344 |
| Molecular Formula | C28H37N7O9 |
| Molecular Weight | 615.64 g/mol |
| Exact Mass | 615.27 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-N-[2-[2-[2-(hydroxymethoxy)ethoxy]ethoxy]ethyl]-5-[[2-[methyl(1H-pyrazol-4-ylmethyl)amino]-2-oxoethyl]amino]-3-oxo-1H-isoindole-4-carboxamide |
| SMILES | CN(Cc1cn[nH]c1)C(=O)CNc1ccc2c(c1C(=O)NCCOCCOCCOCO)C(=O)N(C1CCC(=O)NC1=O)C2 |
| InChI | InChI=1S/C28H37N7O9/c1-34(15-18-12-31-32-13-18)23(38)14-30-20-3-2-19-16-35(21-4-5-22(37)33-26(21)39)28(41)24(19)25(20)27(40)29-6-7-42-8-9-43-10-11-44-17-36/h2-3,12-13,21,30,36H,4-11,14-17H2,1H3,(H,29,40)(H,31,32)(H,33,37,39) |
| InChIKey | ZFWVXDLZTPHDFE-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 204.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.64 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|