C14H12BrN3O4 — CID 167342093
5-bromo-2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindole-4-carboxamide (PubChem CID 167342093) has the molecular formula C14H12BrN3O4 and a molecular weight of 366.17 g/mol. Its IUPAC name is 5-bromo-2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindole-4-carboxamide.
| Compound Name | 5-bromo-2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindole-4-carboxamide |
|---|---|
| PubChem CID | 167342093 |
| Molecular Formula | C14H12BrN3O4 |
| Molecular Weight | 366.17 g/mol |
| Exact Mass | 365.00 |
| IUPAC Name | 5-bromo-2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindole-4-carboxamide |
| SMILES | NC(=O)c1c(Br)ccc2c1C(=O)N(C1CCC(=O)NC1=O)C2 |
| InChI | InChI=1S/C14H12BrN3O4/c15-7-2-1-6-5-18(8-3-4-9(19)17-13(8)21)14(22)10(6)11(7)12(16)20/h1-2,8H,3-5H2,(H2,16,20)(H,17,19,21) |
| InChIKey | DXIZSUHQUINYBD-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.17 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|