C15H12F3N3O4 — CID 167342255
2-(2,6-dioxopiperidin-3-yl)-1-oxo-7-(trifluoromethyl)-3H-isoindole-4-carboxamide (PubChem CID 167342255) has the molecular formula C15H12F3N3O4 and a molecular weight of 355.27 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-1-oxo-7-(trifluoromethyl)-3H-isoindole-4-carboxamide.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-1-oxo-7-(trifluoromethyl)-3H-isoindole-4-carboxamide |
|---|---|
| PubChem CID | 167342255 |
| Molecular Formula | C15H12F3N3O4 |
| Molecular Weight | 355.27 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-1-oxo-7-(trifluoromethyl)-3H-isoindole-4-carboxamide |
| SMILES | NC(=O)c1ccc(C(F)(F)F)c2c1CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C15H12F3N3O4/c16-15(17,18)8-2-1-6(12(19)23)7-5-21(14(25)11(7)8)9-3-4-10(22)20-13(9)24/h1-2,9H,3-5H2,(H2,19,23)(H,20,22,24) |
| InChIKey | ZJFFLNZCTOIOQP-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.27 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|