C15H11F3N2O5 — CID 167342426
2-(2,6-dioxopiperidin-3-yl)-1-oxo-7-(trifluoromethyl)-3H-isoindole-5-carboxylic acid (PubChem CID 167342426) has the molecular formula C15H11F3N2O5 and a molecular weight of 356.26 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-1-oxo-7-(trifluoromethyl)-3H-isoindole-5-carboxylic acid.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-1-oxo-7-(trifluoromethyl)-3H-isoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 167342426 |
| Molecular Formula | C15H11F3N2O5 |
| Molecular Weight | 356.26 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-1-oxo-7-(trifluoromethyl)-3H-isoindole-5-carboxylic acid |
| SMILES | O=C1CCC(N2Cc3cc(C(=O)O)cc(C(F)(F)F)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C15H11F3N2O5/c16-15(17,18)8-4-6(14(24)25)3-7-5-20(13(23)11(7)8)9-1-2-10(21)19-12(9)22/h3-4,9H,1-2,5H2,(H,24,25)(H,19,21,22) |
| InChIKey | VGTWMTWAANSTMK-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.26 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|