C20H19N3O7 — CID 139147305
(3S)-3-(7-amino-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione;3,5-dihydroxybenzoic acid (PubChem CID 139147305) has the molecular formula C20H19N3O7 and a molecular weight of 413.39 g/mol. Its IUPAC name is (3S)-3-(7-amino-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione;3,5-dihydroxybenzoic acid.
| Compound Name | (3S)-3-(7-amino-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione;3,5-dihydroxybenzoic acid |
|---|---|
| PubChem CID | 139147305 |
| Molecular Formula | C20H19N3O7 |
| Molecular Weight | 413.39 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | (3S)-3-(7-amino-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione;3,5-dihydroxybenzoic acid |
| SMILES | Nc1cccc2c1CN([C@H]1CCC(=O)NC1=O)C2=O.O=C(O)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C13H13N3O3.C7H6O4/c14-9-3-1-2-7-8(9)6-16(13(7)19)10-4-5-11(17)15-12(10)18;8-5-1-4(7(10)11)2-6(9)3-5/h1-3,10H,4-6,14H2,(H,15,17,18);1-3,8-9H,(H,10,11)/t10-;/m0./s1 |
| InChIKey | NFVWUWCRBGDMGL-PPHPATTJSA-N |
| XLogP | 0.83 |
| TPSA | 170.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.39 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|