C13H13N3O3 — CID 88575828
5-(7-amino-3-oxo-1H-isoindol-2-yl)-3,3,4-trideuteriopiperidine-2,6-dione (PubChem CID 88575828) has the molecular formula C13H13N3O3 and a molecular weight of 262.28 g/mol. Its IUPAC name is 5-(7-amino-3-oxo-1H-isoindol-2-yl)-3,3,4-trideuteriopiperidine-2,6-dione.
| Compound Name | 5-(7-amino-3-oxo-1H-isoindol-2-yl)-3,3,4-trideuteriopiperidine-2,6-dione |
|---|---|
| PubChem CID | 88575828 |
| Molecular Formula | C13H13N3O3 |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 5-(7-amino-3-oxo-1H-isoindol-2-yl)-3,3,4-trideuteriopiperidine-2,6-dione |
| SMILES | [2H]C1C(N2Cc3c(N)cccc3C2=O)C(=O)NC(=O)C1([2H])[2H] |
| InChI | InChI=1S/C13H13N3O3/c14-9-3-1-2-7-8(9)6-16(13(7)19)10-4-5-11(17)15-12(10)18/h1-3,10H,4-6,14H2,(H,15,17,18)/i4D,5D2 |
| InChIKey | GOTYRUGSSMKFNF-GRRZFFPDSA-N |
| XLogP | 0.03 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|