C14H15N3O2 — CID 58525684
4-amino-2-(3-deuterio-6-methylidene-2-oxopiperidin-3-yl)-3H-isoindol-1-one (PubChem CID 58525684) has the molecular formula C14H15N3O2 and a molecular weight of 258.30 g/mol. Its IUPAC name is 4-amino-2-(3-deuterio-6-methylidene-2-oxopiperidin-3-yl)-3H-isoindol-1-one.
| Compound Name | 4-amino-2-(3-deuterio-6-methylidene-2-oxopiperidin-3-yl)-3H-isoindol-1-one |
|---|---|
| PubChem CID | 58525684 |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 4-amino-2-(3-deuterio-6-methylidene-2-oxopiperidin-3-yl)-3H-isoindol-1-one |
| SMILES | [2H]C1(N2Cc3c(N)cccc3C2=O)CCC(=C)NC1=O |
| InChI | InChI=1S/C14H15N3O2/c1-8-5-6-12(13(18)16-8)17-7-10-9(14(17)19)3-2-4-11(10)15/h2-4,12H,1,5-7,15H2,(H,16,18)/i12D |
| InChIKey | PSCKACLVTVMCPP-UQBWLURTSA-N |
| XLogP | 1.02 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|