C20H17FN2O4 — CID 140817485
(3R)-3-deuterio-3-[7-[(3-fluorophenyl)methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 140817485) has the molecular formula C20H17FN2O4 and a molecular weight of 369.37 g/mol. Its IUPAC name is (3R)-3-deuterio-3-[7-[(3-fluorophenyl)methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | (3R)-3-deuterio-3-[7-[(3-fluorophenyl)methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 140817485 |
| Molecular Formula | C20H17FN2O4 |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | (3R)-3-deuterio-3-[7-[(3-fluorophenyl)methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | [2H][C@@]1(N2Cc3c(OCc4cccc(F)c4)cccc3C2=O)CCC(=O)NC1=O |
| InChI | InChI=1S/C20H17FN2O4/c21-13-4-1-3-12(9-13)11-27-17-6-2-5-14-15(17)10-23(20(14)26)16-7-8-18(24)22-19(16)25/h1-6,9,16H,7-8,10-11H2,(H,22,24,25)/t16-/m1/s1/i16D |
| InChIKey | WDLNFBMWKJYFCW-QKHLJXARSA-N |
| XLogP | 2.17 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|