C15H14N2O6 — CID 167342404
2-(2,6-dioxopiperidin-3-yl)-4-methoxy-3-oxo-1H-isoindole-5-carboxylic acid (PubChem CID 167342404) has the molecular formula C15H14N2O6 and a molecular weight of 318.29 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-methoxy-3-oxo-1H-isoindole-5-carboxylic acid.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-methoxy-3-oxo-1H-isoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 167342404 |
| Molecular Formula | C15H14N2O6 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-methoxy-3-oxo-1H-isoindole-5-carboxylic acid |
| SMILES | COc1c(C(=O)O)ccc2c1C(=O)N(C1CCC(=O)NC1=O)C2 |
| InChI | InChI=1S/C15H14N2O6/c1-23-12-8(15(21)22)3-2-7-6-17(14(20)11(7)12)9-4-5-10(18)16-13(9)19/h2-3,9H,4-6H2,1H3,(H,21,22)(H,16,18,19) |
| InChIKey | JWZXUQSPMWMSST-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|