C14H16N3O4+ — CID 163510675
[2-(2,6-dioxopiperidin-3-yl)-7-methoxy-1-oxo-3H-isoindol-5-yl]azanium (PubChem CID 163510675) has the molecular formula C14H16N3O4+ and a molecular weight of 290.30 g/mol. Its IUPAC name is [2-(2,6-dioxopiperidin-3-yl)-7-methoxy-1-oxo-3H-isoindol-5-yl]azanium.
| Compound Name | [2-(2,6-dioxopiperidin-3-yl)-7-methoxy-1-oxo-3H-isoindol-5-yl]azanium |
|---|---|
| PubChem CID | 163510675 |
| Molecular Formula | C14H16N3O4+ |
| Molecular Weight | 290.30 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | [2-(2,6-dioxopiperidin-3-yl)-7-methoxy-1-oxo-3H-isoindol-5-yl]azanium |
| SMILES | COc1cc([NH3+])cc2c1C(=O)N(C1CCC(=O)NC1=O)C2 |
| InChI | InChI=1S/C14H15N3O4/c1-21-10-5-8(15)4-7-6-17(14(20)12(7)10)9-2-3-11(18)16-13(9)19/h4-5,9H,2-3,6,15H2,1H3,(H,16,18,19)/p+1 |
| InChIKey | DCKWYRWDFIFCNR-UHFFFAOYSA-O |
| XLogP | -0.67 |
| TPSA | 103.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.30 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|