C20H23FN2O5 — CID 171069824
(3S)-3-[6-[3-(dimethoxymethyl)cyclobutyl]-4-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 171069824) has the molecular formula C20H23FN2O5 and a molecular weight of 390.41 g/mol. Its IUPAC name is (3S)-3-[6-[3-(dimethoxymethyl)cyclobutyl]-4-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | (3S)-3-[6-[3-(dimethoxymethyl)cyclobutyl]-4-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 171069824 |
| Molecular Formula | C20H23FN2O5 |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | (3S)-3-[6-[3-(dimethoxymethyl)cyclobutyl]-4-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | COC(OC)C1CC(c2cc(F)c3c(c2)CN([C@H]2CCC(=O)NC2=O)C3=O)C1 |
| InChI | InChI=1S/C20H23FN2O5/c1-27-20(28-2)12-5-10(6-12)11-7-13-9-23(19(26)17(13)14(21)8-11)15-3-4-16(24)22-18(15)25/h7-8,10,12,15,20H,3-6,9H2,1-2H3,(H,22,24,25)/t10?,12?,15-/m0/s1 |
| InChIKey | MHCLUYSNZGOCQH-QHAMSDLMSA-N |
| XLogP | 1.70 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|