C18H21FN2O2 — CID 161388015
5-tert-butyl-7-fluoro-2-(6-methylidene-2-oxopiperidin-3-yl)-3H-isoindol-1-one (PubChem CID 161388015) has the molecular formula C18H21FN2O2 and a molecular weight of 316.38 g/mol. Its IUPAC name is 5-tert-butyl-7-fluoro-2-(6-methylidene-2-oxopiperidin-3-yl)-3H-isoindol-1-one.
| Compound Name | 5-tert-butyl-7-fluoro-2-(6-methylidene-2-oxopiperidin-3-yl)-3H-isoindol-1-one |
|---|---|
| PubChem CID | 161388015 |
| Molecular Formula | C18H21FN2O2 |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 5-tert-butyl-7-fluoro-2-(6-methylidene-2-oxopiperidin-3-yl)-3H-isoindol-1-one |
| SMILES | C=C1CCC(N2Cc3cc(C(C)(C)C)cc(F)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C18H21FN2O2/c1-10-5-6-14(16(22)20-10)21-9-11-7-12(18(2,3)4)8-13(19)15(11)17(21)23/h7-8,14H,1,5-6,9H2,2-4H3,(H,20,22) |
| InChIKey | NBSQQCSRWPWLFH-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |