C21H27FN4O3 — CID 176841283
3-[6-(4-tert-butyl-2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)-4-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 176841283) has the molecular formula C21H27FN4O3 and a molecular weight of 410.52 g/mol. Its IUPAC name is 3-[6-(4-tert-butyl-2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)-4-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-(4-tert-butyl-2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)-4-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 176841283 |
| Molecular Formula | C21H27FN4O3 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | 3-[6-(4-tert-butyl-2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)-4-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | [2H]C1([2H])N(c2cc(F)c3c(c2)CN(C2CCC(=O)NC2=O)C3=O)C([2H])([2H])C([2H])([2H])N(C(C)(C)C)C1([2H])[2H] |
| InChI | InChI=1S/C21H27FN4O3/c1-21(2,3)25-8-6-24(7-9-25)14-10-13-12-26(20(29)18(13)15(22)11-14)16-4-5-17(27)23-19(16)28/h10-11,16H,4-9,12H2,1-3H3,(H,23,27,28)/i6D2,7D2,8D2,9D2 |
| InChIKey | DKFRVTBJELEIPP-COMRDEPKSA-N |
| XLogP | 1.51 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|