C22H27F2N3O3 — CID 176841716
3-[6-(1-tert-butyl-2,2,3,3,5,5,6,6-octadeuteriopiperidin-4-yl)-4,7-difluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 176841716) has the molecular formula C22H27F2N3O3 and a molecular weight of 427.52 g/mol. Its IUPAC name is 3-[6-(1-tert-butyl-2,2,3,3,5,5,6,6-octadeuteriopiperidin-4-yl)-4,7-difluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-(1-tert-butyl-2,2,3,3,5,5,6,6-octadeuteriopiperidin-4-yl)-4,7-difluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 176841716 |
| Molecular Formula | C22H27F2N3O3 |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | 3-[6-(1-tert-butyl-2,2,3,3,5,5,6,6-octadeuteriopiperidin-4-yl)-4,7-difluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | [2H]C1([2H])C(c2cc(F)c3c(c2F)CN(C2CCC(=O)NC2=O)C3=O)C([2H])([2H])C([2H])([2H])N(C(C)(C)C)C1([2H])[2H] |
| InChI | InChI=1S/C22H27F2N3O3/c1-22(2,3)26-8-6-12(7-9-26)13-10-15(23)18-14(19(13)24)11-27(21(18)30)16-4-5-17(28)25-20(16)29/h10,12,16H,4-9,11H2,1-3H3,(H,25,28,29)/i6D2,7D2,8D2,9D2 |
| InChIKey | ZINANEYOGTZKBN-COMRDEPKSA-N |
| XLogP | 2.70 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|