C20H22F3N3O3 — CID 176841366
(3R)-3-[6-(1-tert-butyl-2,2,4,4-tetradeuterioazetidin-3-yl)-4,5,7-trifluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 176841366) has the molecular formula C20H22F3N3O3 and a molecular weight of 413.43 g/mol. Its IUPAC name is (3R)-3-[6-(1-tert-butyl-2,2,4,4-tetradeuterioazetidin-3-yl)-4,5,7-trifluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | (3R)-3-[6-(1-tert-butyl-2,2,4,4-tetradeuterioazetidin-3-yl)-4,5,7-trifluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 176841366 |
| Molecular Formula | C20H22F3N3O3 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | (3R)-3-[6-(1-tert-butyl-2,2,4,4-tetradeuterioazetidin-3-yl)-4,5,7-trifluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | [2H]C1([2H])C(c2c(F)c(F)c3c(c2F)CN([C@@H]2CCC(=O)NC2=O)C3=O)C([2H])([2H])N1C(C)(C)C |
| InChI | InChI=1S/C20H22F3N3O3/c1-20(2,3)25-6-9(7-25)13-15(21)10-8-26(11-4-5-12(27)24-18(11)28)19(29)14(10)17(23)16(13)22/h9,11H,4-8H2,1-3H3,(H,24,27,28)/t11-/m1/s1/i6D2,7D2 |
| InChIKey | MGVCLDAIUPBSBI-QRMXRSDFSA-N |
| XLogP | 2.06 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|